C21H27N3O3S3 — CID 21364809
8-amino-N-[5-(benzenesulfonamido)-2-methylphenyl]dithionane-4-carboxamide (PubChem CID 21364809) has the molecular formula C21H27N3O3S3 and a molecular weight of 465.67 g/mol. Its IUPAC name is 8-amino-N-[5-(benzenesulfonamido)-2-methylphenyl]dithionane-4-carboxamide.
| Compound Name | 8-amino-N-[5-(benzenesulfonamido)-2-methylphenyl]dithionane-4-carboxamide |
|---|---|
| PubChem CID | 21364809 |
| Molecular Formula | C21H27N3O3S3 |
| Molecular Weight | 465.67 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 8-amino-N-[5-(benzenesulfonamido)-2-methylphenyl]dithionane-4-carboxamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccccc2)cc1NC(=O)C1CCCC(N)CSSC1 |
| InChI | InChI=1S/C21H27N3O3S3/c1-15-10-11-18(24-30(26,27)19-8-3-2-4-9-19)12-20(15)23-21(25)16-6-5-7-17(22)14-29-28-13-16/h2-4,8-12,16-17,24H,5-7,13-14,22H2,1H3,(H,23,25) |
| InChIKey | LBKDOSZFPYYRTD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.67 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|