C19H25AcN6O3S- — CID 21364786
actinium;[1-[5-(benzenesulfonamido)-2-methylanilino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]azanide (PubChem CID 21364786) has the molecular formula C19H25AcN6O3S- and a molecular weight of 644.52 g/mol. Its IUPAC name is actinium;[1-[5-(benzenesulfonamido)-2-methylanilino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]azanide.
| Compound Name | actinium;[1-[5-(benzenesulfonamido)-2-methylanilino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]azanide |
|---|---|
| PubChem CID | 21364786 |
| Molecular Formula | C19H25AcN6O3S- |
| Molecular Weight | 644.52 g/mol |
| Exact Mass | 644.20 |
| IUPAC Name | actinium;[1-[5-(benzenesulfonamido)-2-methylanilino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]azanide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccccc2)cc1NC(=O)C([NH-])CCCN=C(N)N.[Ac] |
| InChI | InChI=1S/C19H25N6O3S.Ac/c1-13-9-10-14(25-29(27,28)15-6-3-2-4-7-15)12-17(13)24-18(26)16(20)8-5-11-23-19(21)22;/h2-4,6-7,9-10,12,16,20,25H,5,8,11H2,1H3,(H,24,26)(H4,21,22,23);/q-1; |
| InChIKey | CMWJKNNFDDZCJK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 163.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.52 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|