C27H31NO5S — CID 58248127
5-[3-[(3-methoxy-4-methylphenyl)sulfamoyl]phenyl]-2-(2-phenylethyl)pentanoic acid (PubChem CID 58248127) has the molecular formula C27H31NO5S and a molecular weight of 481.61 g/mol. Its IUPAC name is 5-[3-[(3-methoxy-4-methylphenyl)sulfamoyl]phenyl]-2-(2-phenylethyl)pentanoic acid.
| Compound Name | 5-[3-[(3-methoxy-4-methylphenyl)sulfamoyl]phenyl]-2-(2-phenylethyl)pentanoic acid |
|---|---|
| PubChem CID | 58248127 |
| Molecular Formula | C27H31NO5S |
| Molecular Weight | 481.61 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | 5-[3-[(3-methoxy-4-methylphenyl)sulfamoyl]phenyl]-2-(2-phenylethyl)pentanoic acid |
| SMILES | COc1cc(NS(=O)(=O)c2cccc(CCCC(CCc3ccccc3)C(=O)O)c2)ccc1C |
| InChI | InChI=1S/C27H31NO5S/c1-20-14-17-24(19-26(20)33-2)28-34(31,32)25-13-7-11-22(18-25)10-6-12-23(27(29)30)16-15-21-8-4-3-5-9-21/h3-5,7-9,11,13-14,17-19,23,28H,6,10,12,15-16H2,1-2H3,(H,29,30) |
| InChIKey | LBHCZVUOPUMIKC-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.61 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |