C29H34N2O7S2 — CID 11952638
ethyl 2-[2-[3-[4-[(3,4-dimethoxyphenyl)sulfamoyl]phenyl]propylamino]-2-oxoethyl]sulfanyl-2-phenylacetate (PubChem CID 11952638) has the molecular formula C29H34N2O7S2 and a molecular weight of 586.73 g/mol. Its IUPAC name is ethyl 2-[2-[3-[4-[(3,4-dimethoxyphenyl)sulfamoyl]phenyl]propylamino]-2-oxoethyl]sulfanyl-2-phenylacetate.
| Compound Name | ethyl 2-[2-[3-[4-[(3,4-dimethoxyphenyl)sulfamoyl]phenyl]propylamino]-2-oxoethyl]sulfanyl-2-phenylacetate |
|---|---|
| PubChem CID | 11952638 |
| Molecular Formula | C29H34N2O7S2 |
| Molecular Weight | 586.73 g/mol |
| Exact Mass | 586.18 |
| IUPAC Name | ethyl 2-[2-[3-[4-[(3,4-dimethoxyphenyl)sulfamoyl]phenyl]propylamino]-2-oxoethyl]sulfanyl-2-phenylacetate |
| SMILES | CCOC(=O)C(SCC(=O)NCCCc1ccc(S(=O)(=O)Nc2ccc(OC)c(OC)c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H34N2O7S2/c1-4-38-29(33)28(22-10-6-5-7-11-22)39-20-27(32)30-18-8-9-21-12-15-24(16-13-21)40(34,35)31-23-14-17-25(36-2)26(19-23)37-3/h5-7,10-17,19,28,31H,4,8-9,18,20H2,1-3H3,(H,30,32) |
| InChIKey | OJBJRCICKAAYQN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.73 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|