C27H30N2O4S — CID 24628497
N-(4-butylphenyl)-2-[2-(3,4-dimethoxyanilino)-2-oxoethyl]sulfanylbenzamide (PubChem CID 24628497) has the molecular formula C27H30N2O4S and a molecular weight of 478.61 g/mol. Its IUPAC name is N-(4-butylphenyl)-2-[2-(3,4-dimethoxyanilino)-2-oxoethyl]sulfanylbenzamide.
| Compound Name | N-(4-butylphenyl)-2-[2-(3,4-dimethoxyanilino)-2-oxoethyl]sulfanylbenzamide |
|---|---|
| PubChem CID | 24628497 |
| Molecular Formula | C27H30N2O4S |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | N-(4-butylphenyl)-2-[2-(3,4-dimethoxyanilino)-2-oxoethyl]sulfanylbenzamide |
| SMILES | CCCCc1ccc(NC(=O)c2ccccc2SCC(=O)Nc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C27H30N2O4S/c1-4-5-8-19-11-13-20(14-12-19)29-27(31)22-9-6-7-10-25(22)34-18-26(30)28-21-15-16-23(32-2)24(17-21)33-3/h6-7,9-17H,4-5,8,18H2,1-3H3,(H,28,30)(H,29,31) |
| InChIKey | KRWRXFQWOQPPAW-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |