C27H30N2O5S — CID 24628595
N-(5-tert-butyl-2-hydroxyphenyl)-2-[2-(3,4-dimethoxyanilino)-2-oxoethyl]sulfanylbenzamide (PubChem CID 24628595) has the molecular formula C27H30N2O5S and a molecular weight of 494.61 g/mol. Its IUPAC name is N-(5-tert-butyl-2-hydroxyphenyl)-2-[2-(3,4-dimethoxyanilino)-2-oxoethyl]sulfanylbenzamide.
| Compound Name | N-(5-tert-butyl-2-hydroxyphenyl)-2-[2-(3,4-dimethoxyanilino)-2-oxoethyl]sulfanylbenzamide |
|---|---|
| PubChem CID | 24628595 |
| Molecular Formula | C27H30N2O5S |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | N-(5-tert-butyl-2-hydroxyphenyl)-2-[2-(3,4-dimethoxyanilino)-2-oxoethyl]sulfanylbenzamide |
| SMILES | COc1ccc(NC(=O)CSc2ccccc2C(=O)Nc2cc(C(C)(C)C)ccc2O)cc1OC |
| InChI | InChI=1S/C27H30N2O5S/c1-27(2,3)17-10-12-21(30)20(14-17)29-26(32)19-8-6-7-9-24(19)35-16-25(31)28-18-11-13-22(33-4)23(15-18)34-5/h6-15,30H,16H2,1-5H3,(H,28,31)(H,29,32) |
| InChIKey | YWFAOLXRNOEXIJ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|