C23H21ClN2O4S — CID 26086320
N-(3-chlorophenyl)-2-[2-(3,4-dimethoxyanilino)-2-oxoethyl]sulfanylbenzamide (PubChem CID 26086320) has the molecular formula C23H21ClN2O4S and a molecular weight of 456.95 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[2-(3,4-dimethoxyanilino)-2-oxoethyl]sulfanylbenzamide.
| Compound Name | N-(3-chlorophenyl)-2-[2-(3,4-dimethoxyanilino)-2-oxoethyl]sulfanylbenzamide |
|---|---|
| PubChem CID | 26086320 |
| Molecular Formula | C23H21ClN2O4S |
| Molecular Weight | 456.95 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | N-(3-chlorophenyl)-2-[2-(3,4-dimethoxyanilino)-2-oxoethyl]sulfanylbenzamide |
| SMILES | COc1ccc(NC(=O)CSc2ccccc2C(=O)Nc2cccc(Cl)c2)cc1OC |
| InChI | InChI=1S/C23H21ClN2O4S/c1-29-19-11-10-17(13-20(19)30-2)25-22(27)14-31-21-9-4-3-8-18(21)23(28)26-16-7-5-6-15(24)12-16/h3-13H,14H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | WQPBYXBTANPUFB-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.95 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |