C19H19ClN2O2S — CID 26086407
N-(3-chlorophenyl)-2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzamide (PubChem CID 26086407) has the molecular formula C19H19ClN2O2S and a molecular weight of 374.89 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzamide.
| Compound Name | N-(3-chlorophenyl)-2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzamide |
|---|---|
| PubChem CID | 26086407 |
| Molecular Formula | C19H19ClN2O2S |
| Molecular Weight | 374.89 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | N-(3-chlorophenyl)-2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzamide |
| SMILES | O=C(Nc1cccc(Cl)c1)c1ccccc1SCC(=O)N1CCCC1 |
| InChI | InChI=1S/C19H19ClN2O2S/c20-14-6-5-7-15(12-14)21-19(24)16-8-1-2-9-17(16)25-13-18(23)22-10-3-4-11-22/h1-2,5-9,12H,3-4,10-11,13H2,(H,21,24) |
| InChIKey | IONBNNHPQJWYSB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.89 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |