C20H19F3N2O3S — CID 34440758
2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanyl-N-[3-(trifluoromethoxy)phenyl]benzamide (PubChem CID 34440758) has the molecular formula C20H19F3N2O3S and a molecular weight of 424.44 g/mol. Its IUPAC name is 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanyl-N-[3-(trifluoromethoxy)phenyl]benzamide.
| Compound Name | 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanyl-N-[3-(trifluoromethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 34440758 |
| Molecular Formula | C20H19F3N2O3S |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanyl-N-[3-(trifluoromethoxy)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(OC(F)(F)F)c1)c1ccccc1SCC(=O)N1CCCC1 |
| InChI | InChI=1S/C20H19F3N2O3S/c21-20(22,23)28-15-7-5-6-14(12-15)24-19(27)16-8-1-2-9-17(16)29-13-18(26)25-10-3-4-11-25/h1-2,5-9,12H,3-4,10-11,13H2,(H,24,27) |
| InChIKey | NFSAGGHQEVYSRC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |