C27H27NO3 — CID 46244326
2-[2-[4-(3-cyano-4-methoxyphenyl)phenyl]ethyl]-5-phenylpentanoic acid (PubChem CID 46244326) has the molecular formula C27H27NO3 and a molecular weight of 413.52 g/mol. Its IUPAC name is 2-[2-[4-(3-cyano-4-methoxyphenyl)phenyl]ethyl]-5-phenylpentanoic acid.
| Compound Name | 2-[2-[4-(3-cyano-4-methoxyphenyl)phenyl]ethyl]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 46244326 |
| Molecular Formula | C27H27NO3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 2-[2-[4-(3-cyano-4-methoxyphenyl)phenyl]ethyl]-5-phenylpentanoic acid |
| SMILES | COc1ccc(-c2ccc(CCC(CCCc3ccccc3)C(=O)O)cc2)cc1C#N |
| InChI | InChI=1S/C27H27NO3/c1-31-26-17-16-24(18-25(26)19-28)22-13-10-21(11-14-22)12-15-23(27(29)30)9-5-8-20-6-3-2-4-7-20/h2-4,6-7,10-11,13-14,16-18,23H,5,8-9,12,15H2,1H3,(H,29,30) |
| InChIKey | PNZNVSYMISKWHR-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |