C30H30O3 — CID 46244432
2-[2-[4-(4-methoxyphenyl)phenyl]ethyl]-5-naphthalen-1-ylpentanoic acid (PubChem CID 46244432) has the molecular formula C30H30O3 and a molecular weight of 438.57 g/mol. Its IUPAC name is 2-[2-[4-(4-methoxyphenyl)phenyl]ethyl]-5-naphthalen-1-ylpentanoic acid.
| Compound Name | 2-[2-[4-(4-methoxyphenyl)phenyl]ethyl]-5-naphthalen-1-ylpentanoic acid |
|---|---|
| PubChem CID | 46244432 |
| Molecular Formula | C30H30O3 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 2-[2-[4-(4-methoxyphenyl)phenyl]ethyl]-5-naphthalen-1-ylpentanoic acid |
| SMILES | COc1ccc(-c2ccc(CCC(CCCc3cccc4ccccc34)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C30H30O3/c1-33-28-20-18-24(19-21-28)23-15-12-22(13-16-23)14-17-27(30(31)32)10-5-9-26-8-4-7-25-6-2-3-11-29(25)26/h2-4,6-8,11-13,15-16,18-21,27H,5,9-10,14,17H2,1H3,(H,31,32) |
| InChIKey | FSZLEQSPTGVSDX-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |