C27H25Cl2NO3 — CID 143128406
6-(2-chloro-4-cyanophenoxy)-2-[2-[4-(4-chlorophenyl)phenyl]ethyl]hexanoic acid (PubChem CID 143128406) has the molecular formula C27H25Cl2NO3 and a molecular weight of 482.41 g/mol. Its IUPAC name is 6-(2-chloro-4-cyanophenoxy)-2-[2-[4-(4-chlorophenyl)phenyl]ethyl]hexanoic acid.
| Compound Name | 6-(2-chloro-4-cyanophenoxy)-2-[2-[4-(4-chlorophenyl)phenyl]ethyl]hexanoic acid |
|---|---|
| PubChem CID | 143128406 |
| Molecular Formula | C27H25Cl2NO3 |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | 6-(2-chloro-4-cyanophenoxy)-2-[2-[4-(4-chlorophenyl)phenyl]ethyl]hexanoic acid |
| SMILES | N#Cc1ccc(OCCCCC(CCc2ccc(-c3ccc(Cl)cc3)cc2)C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C27H25Cl2NO3/c28-24-13-11-22(12-14-24)21-8-4-19(5-9-21)6-10-23(27(31)32)3-1-2-16-33-26-15-7-20(18-30)17-25(26)29/h4-5,7-9,11-15,17,23H,1-3,6,10,16H2,(H,31,32) |
| InChIKey | BIWBMCWZGZOLBD-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|