C19H24Ac2N6O3S-2 — CID 59100351
actinium;[amino-[[(4R)-4-azanidyl-5-[5-(benzenesulfonamido)-2-methylanilino]-5-oxopentyl]amino]methylidene]azanide (PubChem CID 59100351) has the molecular formula C19H24Ac2N6O3S-2 and a molecular weight of 870.51 g/mol. Its IUPAC name is actinium;[amino-[[(4R)-4-azanidyl-5-[5-(benzenesulfonamido)-2-methylanilino]-5-oxopentyl]amino]methylidene]azanide.
| Compound Name | actinium;[amino-[[(4R)-4-azanidyl-5-[5-(benzenesulfonamido)-2-methylanilino]-5-oxopentyl]amino]methylidene]azanide |
|---|---|
| PubChem CID | 59100351 |
| Molecular Formula | C19H24Ac2N6O3S-2 |
| Molecular Weight | 870.51 g/mol |
| Exact Mass | 870.22 |
| IUPAC Name | actinium;[amino-[[(4R)-4-azanidyl-5-[5-(benzenesulfonamido)-2-methylanilino]-5-oxopentyl]amino]methylidene]azanide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccccc2)cc1NC(=O)[C@H]([NH-])CCCNC(=[N-])N.[Ac].[Ac] |
| InChI | InChI=1S/C19H24N6O3S.2Ac/c1-13-9-10-14(25-29(27,28)15-6-3-2-4-7-15)12-17(13)24-18(26)16(20)8-5-11-23-19(21)22;;/h2-4,6-7,9-10,12,16,20,25H,5,8,11H2,1H3,(H4-,21,22,23,24,26);;/q-2;;/t16-;;/m1../s1 |
| InChIKey | IHVHVEHYYKEWCR-GGMCWBHBSA-N |
| XLogP | 2.41 |
| TPSA | 159.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.51 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|