C27H34N6O2 — CID 51134080
1-(3-anilinopropyl)-3-[3-(3-anilinopropylcarbamoylamino)-4-methylphenyl]urea (PubChem CID 51134080) has the molecular formula C27H34N6O2 and a molecular weight of 474.61 g/mol. Its IUPAC name is 1-(3-anilinopropyl)-3-[3-(3-anilinopropylcarbamoylamino)-4-methylphenyl]urea.
| Compound Name | 1-(3-anilinopropyl)-3-[3-(3-anilinopropylcarbamoylamino)-4-methylphenyl]urea |
|---|---|
| PubChem CID | 51134080 |
| Molecular Formula | C27H34N6O2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | 1-(3-anilinopropyl)-3-[3-(3-anilinopropylcarbamoylamino)-4-methylphenyl]urea |
| SMILES | Cc1ccc(NC(=O)NCCCNc2ccccc2)cc1NC(=O)NCCCNc1ccccc1 |
| InChI | InChI=1S/C27H34N6O2/c1-21-14-15-24(32-26(34)30-18-8-16-28-22-10-4-2-5-11-22)20-25(21)33-27(35)31-19-9-17-29-23-12-6-3-7-13-23/h2-7,10-15,20,28-29H,8-9,16-19H2,1H3,(H2,30,32,34)(H2,31,33,35) |
| InChIKey | CCRZDYNSUQPQRW-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 106.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|