C22H19F2N3O4S — CID 55700509
4-(difluoromethylsulfonyl)-N-[2-methyl-5-(phenylcarbamoylamino)phenyl]benzamide (PubChem CID 55700509) has the molecular formula C22H19F2N3O4S and a molecular weight of 459.47 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-[2-methyl-5-(phenylcarbamoylamino)phenyl]benzamide.
| Compound Name | 4-(difluoromethylsulfonyl)-N-[2-methyl-5-(phenylcarbamoylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 55700509 |
| Molecular Formula | C22H19F2N3O4S |
| Molecular Weight | 459.47 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-[2-methyl-5-(phenylcarbamoylamino)phenyl]benzamide |
| SMILES | Cc1ccc(NC(=O)Nc2ccccc2)cc1NC(=O)c1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C22H19F2N3O4S/c1-14-7-10-17(26-22(29)25-16-5-3-2-4-6-16)13-19(14)27-20(28)15-8-11-18(12-9-15)32(30,31)21(23)24/h2-13,21H,1H3,(H,27,28)(H2,25,26,29) |
| InChIKey | DZHWNUGRTPAFRW-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.47 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |