C15H12ClF2NO3S — CID 8502246
N-(5-chloro-2-methylphenyl)-4-(difluoromethylsulfonyl)benzamide (PubChem CID 8502246) has the molecular formula C15H12ClF2NO3S and a molecular weight of 359.78 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-4-(difluoromethylsulfonyl)benzamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-4-(difluoromethylsulfonyl)benzamide |
|---|---|
| PubChem CID | 8502246 |
| Molecular Formula | C15H12ClF2NO3S |
| Molecular Weight | 359.78 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-4-(difluoromethylsulfonyl)benzamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)c1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C15H12ClF2NO3S/c1-9-2-5-11(16)8-13(9)19-14(20)10-3-6-12(7-4-10)23(21,22)15(17)18/h2-8,15H,1H3,(H,19,20) |
| InChIKey | NVWGZZCAUXJASM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.78 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |