C16H14ClF2NO4S — CID 2668895
N-(4-chloro-2-methoxy-5-methylphenyl)-4-(difluoromethylsulfonyl)benzamide (PubChem CID 2668895) has the molecular formula C16H14ClF2NO4S and a molecular weight of 389.81 g/mol. Its IUPAC name is N-(4-chloro-2-methoxy-5-methylphenyl)-4-(difluoromethylsulfonyl)benzamide.
| Compound Name | N-(4-chloro-2-methoxy-5-methylphenyl)-4-(difluoromethylsulfonyl)benzamide |
|---|---|
| PubChem CID | 2668895 |
| Molecular Formula | C16H14ClF2NO4S |
| Molecular Weight | 389.81 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | N-(4-chloro-2-methoxy-5-methylphenyl)-4-(difluoromethylsulfonyl)benzamide |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)c1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C16H14ClF2NO4S/c1-9-7-13(14(24-2)8-12(9)17)20-15(21)10-3-5-11(6-4-10)25(22,23)16(18)19/h3-8,16H,1-2H3,(H,20,21) |
| InChIKey | SGFVDSTTWWNMOE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.81 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |