C21H15F2NO5S — CID 4876013
4-(difluoromethylsulfonyl)-N-(2-methoxydibenzofuran-3-yl)benzamide (PubChem CID 4876013) has the molecular formula C21H15F2NO5S and a molecular weight of 431.42 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-(2-methoxydibenzofuran-3-yl)benzamide.
| Compound Name | 4-(difluoromethylsulfonyl)-N-(2-methoxydibenzofuran-3-yl)benzamide |
|---|---|
| PubChem CID | 4876013 |
| Molecular Formula | C21H15F2NO5S |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-(2-methoxydibenzofuran-3-yl)benzamide |
| SMILES | COc1cc2c(cc1NC(=O)c1ccc(S(=O)(=O)C(F)F)cc1)oc1ccccc12 |
| InChI | InChI=1S/C21H15F2NO5S/c1-28-19-10-15-14-4-2-3-5-17(14)29-18(15)11-16(19)24-20(25)12-6-8-13(9-7-12)30(26,27)21(22)23/h2-11,21H,1H3,(H,24,25) |
| InChIKey | LHPICZOUEHJHRB-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |