C19H15NO3S — CID 2971310
N-(2-methoxydibenzofuran-3-yl)-5-methylthiophene-3-carboxamide (PubChem CID 2971310) has the molecular formula C19H15NO3S and a molecular weight of 337.40 g/mol. Its IUPAC name is N-(2-methoxydibenzofuran-3-yl)-5-methylthiophene-3-carboxamide.
| Compound Name | N-(2-methoxydibenzofuran-3-yl)-5-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 2971310 |
| Molecular Formula | C19H15NO3S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | N-(2-methoxydibenzofuran-3-yl)-5-methylthiophene-3-carboxamide |
| SMILES | COc1cc2c(cc1NC(=O)c1csc(C)c1)oc1ccccc12 |
| InChI | InChI=1S/C19H15NO3S/c1-11-7-12(10-24-11)19(21)20-15-9-17-14(8-18(15)22-2)13-5-3-4-6-16(13)23-17/h3-10H,1-2H3,(H,20,21) |
| InChIKey | FLDDXVOJCSIFES-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |