C25H19NO3S — CID 7668783
N-(2-methoxydibenzofuran-3-yl)-3-(4-methylphenyl)thiophene-2-carboxamide (PubChem CID 7668783) has the molecular formula C25H19NO3S and a molecular weight of 413.50 g/mol. Its IUPAC name is N-(2-methoxydibenzofuran-3-yl)-3-(4-methylphenyl)thiophene-2-carboxamide.
| Compound Name | N-(2-methoxydibenzofuran-3-yl)-3-(4-methylphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 7668783 |
| Molecular Formula | C25H19NO3S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | N-(2-methoxydibenzofuran-3-yl)-3-(4-methylphenyl)thiophene-2-carboxamide |
| SMILES | COc1cc2c(cc1NC(=O)c1sccc1-c1ccc(C)cc1)oc1ccccc12 |
| InChI | InChI=1S/C25H19NO3S/c1-15-7-9-16(10-8-15)17-11-12-30-24(17)25(27)26-20-14-22-19(13-23(20)28-2)18-5-3-4-6-21(18)29-22/h3-14H,1-2H3,(H,26,27) |
| InChIKey | XFKOEMDCXAIRGR-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |