C18H15Cl2NO3 — CID 2225841
(1S)-2,2-dichloro-N-(2-methoxydibenzofuran-3-yl)-1-methylcyclopropane-1-carboxamide (PubChem CID 2225841) has the molecular formula C18H15Cl2NO3 and a molecular weight of 364.23 g/mol. Its IUPAC name is (1S)-2,2-dichloro-N-(2-methoxydibenzofuran-3-yl)-1-methylcyclopropane-1-carboxamide.
| Compound Name | (1S)-2,2-dichloro-N-(2-methoxydibenzofuran-3-yl)-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 2225841 |
| Molecular Formula | C18H15Cl2NO3 |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | (1S)-2,2-dichloro-N-(2-methoxydibenzofuran-3-yl)-1-methylcyclopropane-1-carboxamide |
| SMILES | COc1cc2c(cc1NC(=O)[C@]1(C)CC1(Cl)Cl)oc1ccccc12 |
| InChI | InChI=1S/C18H15Cl2NO3/c1-17(9-18(17,19)20)16(22)21-12-8-14-11(7-15(12)23-2)10-5-3-4-6-13(10)24-14/h3-8H,9H2,1-2H3,(H,21,22)/t17-/m0/s1 |
| InChIKey | IMEPLWOWPFSZGR-KRWDZBQOSA-N |
| XLogP | 5.12 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|