C24H24ClNO3 — CID 7962448
(5S,7R)-3-chloro-N-(2-methoxydibenzofuran-3-yl)adamantane-1-carboxamide (PubChem CID 7962448) has the molecular formula C24H24ClNO3 and a molecular weight of 409.91 g/mol. Its IUPAC name is (5S,7R)-3-chloro-N-(2-methoxydibenzofuran-3-yl)adamantane-1-carboxamide.
| Compound Name | (5S,7R)-3-chloro-N-(2-methoxydibenzofuran-3-yl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 7962448 |
| Molecular Formula | C24H24ClNO3 |
| Molecular Weight | 409.91 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | (5S,7R)-3-chloro-N-(2-methoxydibenzofuran-3-yl)adamantane-1-carboxamide |
| SMILES | COc1cc2c(cc1NC(=O)C13C[C@@H]4C[C@@H](CC(Cl)(C4)C1)C3)oc1ccccc12 |
| InChI | InChI=1S/C24H24ClNO3/c1-28-21-7-17-16-4-2-3-5-19(16)29-20(17)8-18(21)26-22(27)23-9-14-6-15(10-23)12-24(25,11-14)13-23/h2-5,7-8,14-15H,6,9-13H2,1H3,(H,26,27)/t14-,15+,23?,24? |
| InChIKey | VDIUTPSMGUDBSP-DOEIMJQGSA-N |
| XLogP | 6.11 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.91 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|