C27H28BrNO5 — CID 25346305
[(2R)-1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] (5R,7S)-3-bromoadamantane-1-carboxylate (PubChem CID 25346305) has the molecular formula C27H28BrNO5 and a molecular weight of 526.43 g/mol. Its IUPAC name is [(2R)-1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] (5R,7S)-3-bromoadamantane-1-carboxylate.
| Compound Name | [(2R)-1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] (5R,7S)-3-bromoadamantane-1-carboxylate |
|---|---|
| PubChem CID | 25346305 |
| Molecular Formula | C27H28BrNO5 |
| Molecular Weight | 526.43 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | [(2R)-1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] (5R,7S)-3-bromoadamantane-1-carboxylate |
| SMILES | COc1cc2c(cc1NC(=O)[C@@H](C)OC(=O)C13C[C@@H]4C[C@@H](CC(Br)(C4)C1)C3)oc1ccccc12 |
| InChI | InChI=1S/C27H28BrNO5/c1-15(33-25(31)26-10-16-7-17(11-26)13-27(28,12-16)14-26)24(30)29-20-9-22-19(8-23(20)32-2)18-5-3-4-6-21(18)34-22/h3-6,8-9,15-17H,7,10-14H2,1-2H3,(H,29,30)/t15-,16-,17+,26?,27?/m1/s1 |
| InChIKey | RCGRGZKNWUPYOQ-XGXFZRBISA-N |
| XLogP | 6.20 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.43 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|