C25H27NO3 — CID 5144773
2-(1-adamantyl)-N-(2-methoxydibenzofuran-3-yl)acetamide (PubChem CID 5144773) has the molecular formula C25H27NO3 and a molecular weight of 389.50 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-(2-methoxydibenzofuran-3-yl)acetamide.
| Compound Name | 2-(1-adamantyl)-N-(2-methoxydibenzofuran-3-yl)acetamide |
|---|---|
| PubChem CID | 5144773 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 2-(1-adamantyl)-N-(2-methoxydibenzofuran-3-yl)acetamide |
| SMILES | COc1cc2c(cc1NC(=O)CC13CC4CC(CC(C4)C1)C3)oc1ccccc12 |
| InChI | InChI=1S/C25H27NO3/c1-28-23-9-19-18-4-2-3-5-21(18)29-22(19)10-20(23)26-24(27)14-25-11-15-6-16(12-25)8-17(7-15)13-25/h2-5,9-10,15-17H,6-8,11-14H2,1H3,(H,26,27) |
| InChIKey | UPLNOPAFFLZHHB-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |