C17H14F3NO4 — CID 55488412
N-(2-methoxydibenzofuran-3-yl)-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 55488412) has the molecular formula C17H14F3NO4 and a molecular weight of 353.30 g/mol. Its IUPAC name is N-(2-methoxydibenzofuran-3-yl)-2-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | N-(2-methoxydibenzofuran-3-yl)-2-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 55488412 |
| Molecular Formula | C17H14F3NO4 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | N-(2-methoxydibenzofuran-3-yl)-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | COc1cc2c(cc1NC(=O)COCC(F)(F)F)oc1ccccc12 |
| InChI | InChI=1S/C17H14F3NO4/c1-23-15-6-11-10-4-2-3-5-13(10)25-14(11)7-12(15)21-16(22)8-24-9-17(18,19)20/h2-7H,8-9H2,1H3,(H,21,22) |
| InChIKey | OHXCTLJOJLZZAQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |