C17H14F6NO5P — CID 3105325
N-[bis(2,2,2-trifluoroethoxy)phosphoryl]-2-methoxydibenzofuran-3-amine (PubChem CID 3105325) has the molecular formula C17H14F6NO5P and a molecular weight of 457.26 g/mol. Its IUPAC name is N-[bis(2,2,2-trifluoroethoxy)phosphoryl]-2-methoxydibenzofuran-3-amine.
| Compound Name | N-[bis(2,2,2-trifluoroethoxy)phosphoryl]-2-methoxydibenzofuran-3-amine |
|---|---|
| PubChem CID | 3105325 |
| Molecular Formula | C17H14F6NO5P |
| Molecular Weight | 457.26 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | N-[bis(2,2,2-trifluoroethoxy)phosphoryl]-2-methoxydibenzofuran-3-amine |
| SMILES | COc1cc2c(cc1NP(=O)(OCC(F)(F)F)OCC(F)(F)F)oc1ccccc12 |
| InChI | InChI=1S/C17H14F6NO5P/c1-26-15-6-11-10-4-2-3-5-13(10)29-14(11)7-12(15)24-30(25,27-8-16(18,19)20)28-9-17(21,22)23/h2-7H,8-9H2,1H3,(H,24,25) |
| InChIKey | SRZVPRJTLVGNQY-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.26 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|