C20H13ClF3NO4S — CID 2457636
2-chloro-N-(2-methoxydibenzofuran-3-yl)-5-(trifluoromethyl)benzenesulfonamide (PubChem CID 2457636) has the molecular formula C20H13ClF3NO4S and a molecular weight of 455.84 g/mol. Its IUPAC name is 2-chloro-N-(2-methoxydibenzofuran-3-yl)-5-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 2-chloro-N-(2-methoxydibenzofuran-3-yl)-5-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 2457636 |
| Molecular Formula | C20H13ClF3NO4S |
| Molecular Weight | 455.84 g/mol |
| Exact Mass | 455.02 |
| IUPAC Name | 2-chloro-N-(2-methoxydibenzofuran-3-yl)-5-(trifluoromethyl)benzenesulfonamide |
| SMILES | COc1cc2c(cc1NS(=O)(=O)c1cc(C(F)(F)F)ccc1Cl)oc1ccccc12 |
| InChI | InChI=1S/C20H13ClF3NO4S/c1-28-18-9-13-12-4-2-3-5-16(12)29-17(13)10-15(18)25-30(26,27)19-8-11(20(22,23)24)6-7-14(19)21/h2-10,25H,1H3 |
| InChIKey | KUPDIRNRORLWEM-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.84 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |