C20H12ClF3N2O4S — CID 10276840
N'-[2-chloro-5-(trifluoromethyl)phenyl]sulfonyldibenzofuran-2-carbohydrazide (PubChem CID 10276840) has the molecular formula C20H12ClF3N2O4S and a molecular weight of 468.84 g/mol. Its IUPAC name is N'-[2-chloro-5-(trifluoromethyl)phenyl]sulfonyldibenzofuran-2-carbohydrazide.
| Compound Name | N'-[2-chloro-5-(trifluoromethyl)phenyl]sulfonyldibenzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 10276840 |
| Molecular Formula | C20H12ClF3N2O4S |
| Molecular Weight | 468.84 g/mol |
| Exact Mass | 468.02 |
| IUPAC Name | N'-[2-chloro-5-(trifluoromethyl)phenyl]sulfonyldibenzofuran-2-carbohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1cc(C(F)(F)F)ccc1Cl)c1ccc2oc3ccccc3c2c1 |
| InChI | InChI=1S/C20H12ClF3N2O4S/c21-15-7-6-12(20(22,23)24)10-18(15)31(28,29)26-25-19(27)11-5-8-17-14(9-11)13-3-1-2-4-16(13)30-17/h1-10,26H,(H,25,27) |
| InChIKey | CCDNYTVQVPXJGR-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.84 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|