C21H11F6NO2 — CID 18876143
N-[3,5-bis(trifluoromethyl)phenyl]dibenzofuran-2-carboxamide (PubChem CID 18876143) has the molecular formula C21H11F6NO2 and a molecular weight of 423.31 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]dibenzofuran-2-carboxamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]dibenzofuran-2-carboxamide |
|---|---|
| PubChem CID | 18876143 |
| Molecular Formula | C21H11F6NO2 |
| Molecular Weight | 423.31 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]dibenzofuran-2-carboxamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccc2oc3ccccc3c2c1 |
| InChI | InChI=1S/C21H11F6NO2/c22-20(23,24)12-8-13(21(25,26)27)10-14(9-12)28-19(29)11-5-6-18-16(7-11)15-3-1-2-4-17(15)30-18/h1-10H,(H,28,29) |
| InChIKey | OBAVFFXFXUNRFE-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.31 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |