C15H8F6INO — CID 94844570
N-[3,5-bis(trifluoromethyl)phenyl]-4-iodobenzamide (PubChem CID 94844570) has the molecular formula C15H8F6INO and a molecular weight of 459.13 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-4-iodobenzamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-4-iodobenzamide |
|---|---|
| PubChem CID | 94844570 |
| Molecular Formula | C15H8F6INO |
| Molecular Weight | 459.13 g/mol |
| Exact Mass | 458.96 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-4-iodobenzamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccc(I)cc1 |
| InChI | InChI=1S/C15H8F6INO/c16-14(17,18)9-5-10(15(19,20)21)7-12(6-9)23-13(24)8-1-3-11(22)4-2-8/h1-7H,(H,23,24) |
| InChIKey | DJLWGSIDJDINHF-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.13 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|