C14H8Br2F3NO2 — CID 25222880
N-(3,5-dibromo-4-hydroxyphenyl)-4-(trifluoromethyl)benzamide (PubChem CID 25222880) has the molecular formula C14H8Br2F3NO2 and a molecular weight of 439.03 g/mol. Its IUPAC name is N-(3,5-dibromo-4-hydroxyphenyl)-4-(trifluoromethyl)benzamide.
| Compound Name | N-(3,5-dibromo-4-hydroxyphenyl)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 25222880 |
| Molecular Formula | C14H8Br2F3NO2 |
| Molecular Weight | 439.03 g/mol |
| Exact Mass | 436.89 |
| IUPAC Name | N-(3,5-dibromo-4-hydroxyphenyl)-4-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1cc(Br)c(O)c(Br)c1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H8Br2F3NO2/c15-10-5-9(6-11(16)12(10)21)20-13(22)7-1-3-8(4-2-7)14(17,18)19/h1-6,21H,(H,20,22) |
| InChIKey | UIRZGORFQBLDHE-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.03 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|