C15H7Br2F6NO2 — CID 25222881
N-(3,5-dibromo-4-hydroxyphenyl)-2,5-bis(trifluoromethyl)benzamide (PubChem CID 25222881) has the molecular formula C15H7Br2F6NO2 and a molecular weight of 507.02 g/mol. Its IUPAC name is N-(3,5-dibromo-4-hydroxyphenyl)-2,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-(3,5-dibromo-4-hydroxyphenyl)-2,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 25222881 |
| Molecular Formula | C15H7Br2F6NO2 |
| Molecular Weight | 507.02 g/mol |
| Exact Mass | 504.87 |
| IUPAC Name | N-(3,5-dibromo-4-hydroxyphenyl)-2,5-bis(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1cc(Br)c(O)c(Br)c1)c1cc(C(F)(F)F)ccc1C(F)(F)F |
| InChI | InChI=1S/C15H7Br2F6NO2/c16-10-4-7(5-11(17)12(10)25)24-13(26)8-3-6(14(18,19)20)1-2-9(8)15(21,22)23/h1-5,25H,(H,24,26) |
| InChIKey | ZLISXAZGDSYXRB-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.02 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|