C24H13F6N3O2 — CID 129303111
N-[3-(quinoxaline-6-carbonyl)phenyl]-2,5-bis(trifluoromethyl)benzamide (PubChem CID 129303111) has the molecular formula C24H13F6N3O2 and a molecular weight of 489.38 g/mol. Its IUPAC name is N-[3-(quinoxaline-6-carbonyl)phenyl]-2,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[3-(quinoxaline-6-carbonyl)phenyl]-2,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 129303111 |
| Molecular Formula | C24H13F6N3O2 |
| Molecular Weight | 489.38 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | N-[3-(quinoxaline-6-carbonyl)phenyl]-2,5-bis(trifluoromethyl)benzamide |
| SMILES | O=C(c1cccc(NC(=O)c2cc(C(F)(F)F)ccc2C(F)(F)F)c1)c1ccc2nccnc2c1 |
| InChI | InChI=1S/C24H13F6N3O2/c25-23(26,27)15-5-6-18(24(28,29)30)17(12-15)22(35)33-16-3-1-2-13(10-16)21(34)14-4-7-19-20(11-14)32-9-8-31-19/h1-12H,(H,33,35) |
| InChIKey | XUHXRYWNKUECIT-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.38 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |