C23H14F4N4O2 — CID 89443138
1-[3-fluoro-5-(quinoxaline-6-carbonyl)phenyl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 89443138) has the molecular formula C23H14F4N4O2 and a molecular weight of 454.38 g/mol. Its IUPAC name is 1-[3-fluoro-5-(quinoxaline-6-carbonyl)phenyl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-fluoro-5-(quinoxaline-6-carbonyl)phenyl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 89443138 |
| Molecular Formula | C23H14F4N4O2 |
| Molecular Weight | 454.38 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 1-[3-fluoro-5-(quinoxaline-6-carbonyl)phenyl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)Nc1cc(F)cc(C(=O)c2ccc3nccnc3c2)c1 |
| InChI | InChI=1S/C23H14F4N4O2/c24-16-9-14(21(32)13-1-6-19-20(11-13)29-8-7-28-19)10-18(12-16)31-22(33)30-17-4-2-15(3-5-17)23(25,26)27/h1-12H,(H2,30,31,33) |
| InChIKey | CBBQZDKNHLHXCD-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.38 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |