C23H11ClF6N4O2 — CID 71532996
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[2,4,5-trifluoro-3-(quinoxaline-6-carbonyl)phenyl]urea (PubChem CID 71532996) has the molecular formula C23H11ClF6N4O2 and a molecular weight of 524.81 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[2,4,5-trifluoro-3-(quinoxaline-6-carbonyl)phenyl]urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[2,4,5-trifluoro-3-(quinoxaline-6-carbonyl)phenyl]urea |
|---|---|
| PubChem CID | 71532996 |
| Molecular Formula | C23H11ClF6N4O2 |
| Molecular Weight | 524.81 g/mol |
| Exact Mass | 524.05 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[2,4,5-trifluoro-3-(quinoxaline-6-carbonyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(Cl)c(C(F)(F)F)c1)Nc1cc(F)c(F)c(C(=O)c2ccc3nccnc3c2)c1F |
| InChI | InChI=1S/C23H11ClF6N4O2/c24-13-3-2-11(8-12(13)23(28,29)30)33-22(36)34-17-9-14(25)19(26)18(20(17)27)21(35)10-1-4-15-16(7-10)32-6-5-31-15/h1-9H,(H2,33,34,36) |
| InChIKey | FWYSXZWGNNXVMR-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.81 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|