C22H14ClFN4O2 — CID 75203369
1-(3-chlorophenyl)-3-[2-fluoro-4-(quinoxaline-6-carbonyl)phenyl]urea (PubChem CID 75203369) has the molecular formula C22H14ClFN4O2 and a molecular weight of 420.83 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[2-fluoro-4-(quinoxaline-6-carbonyl)phenyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[2-fluoro-4-(quinoxaline-6-carbonyl)phenyl]urea |
|---|---|
| PubChem CID | 75203369 |
| Molecular Formula | C22H14ClFN4O2 |
| Molecular Weight | 420.83 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[2-fluoro-4-(quinoxaline-6-carbonyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(Cl)c1)Nc1ccc(C(=O)c2ccc3nccnc3c2)cc1F |
| InChI | InChI=1S/C22H14ClFN4O2/c23-15-2-1-3-16(12-15)27-22(30)28-18-6-4-13(10-17(18)24)21(29)14-5-7-19-20(11-14)26-9-8-25-19/h1-12H,(H2,27,28,30) |
| InChIKey | MRKXHFOPWZZIPU-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.83 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |