C17H9F6NO5 — CID 45428652
5-[[3,5-bis(trifluoromethyl)benzoyl]amino]benzene-1,3-dicarboxylic acid (PubChem CID 45428652) has the molecular formula C17H9F6NO5 and a molecular weight of 421.25 g/mol. Its IUPAC name is 5-[[3,5-bis(trifluoromethyl)benzoyl]amino]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[[3,5-bis(trifluoromethyl)benzoyl]amino]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 45428652 |
| Molecular Formula | C17H9F6NO5 |
| Molecular Weight | 421.25 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | 5-[[3,5-bis(trifluoromethyl)benzoyl]amino]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(NC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(=O)O)c1 |
| InChI | InChI=1S/C17H9F6NO5/c18-16(19,20)10-2-7(3-11(6-10)17(21,22)23)13(25)24-12-4-8(14(26)27)1-9(5-12)15(28)29/h1-6H,(H,24,25)(H,26,27)(H,28,29) |
| InChIKey | CLCSHBLQTAJCIJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.25 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |