C18H12F6N2O4 — CID 45435057
2-[[4-[[3,5-bis(trifluoromethyl)benzoyl]amino]benzoyl]amino]acetic acid (PubChem CID 45435057) has the molecular formula C18H12F6N2O4 and a molecular weight of 434.29 g/mol. Its IUPAC name is 2-[[4-[[3,5-bis(trifluoromethyl)benzoyl]amino]benzoyl]amino]acetic acid.
| Compound Name | 2-[[4-[[3,5-bis(trifluoromethyl)benzoyl]amino]benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 45435057 |
| Molecular Formula | C18H12F6N2O4 |
| Molecular Weight | 434.29 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | 2-[[4-[[3,5-bis(trifluoromethyl)benzoyl]amino]benzoyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1ccc(NC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C18H12F6N2O4/c19-17(20,21)11-5-10(6-12(7-11)18(22,23)24)16(30)26-13-3-1-9(2-4-13)15(29)25-8-14(27)28/h1-7H,8H2,(H,25,29)(H,26,30)(H,27,28) |
| InChIKey | OHQIAMMJWCFNCL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.29 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |