C19H19NO5 — CID 17361859
5-[(4-tert-butylbenzoyl)amino]benzene-1,3-dicarboxylic acid (PubChem CID 17361859) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is 5-[(4-tert-butylbenzoyl)amino]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[(4-tert-butylbenzoyl)amino]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 17361859 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 5-[(4-tert-butylbenzoyl)amino]benzene-1,3-dicarboxylic acid |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2cc(C(=O)O)cc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C19H19NO5/c1-19(2,3)14-6-4-11(5-7-14)16(21)20-15-9-12(17(22)23)8-13(10-15)18(24)25/h4-10H,1-3H3,(H,20,21)(H,22,23)(H,24,25) |
| InChIKey | ZCQZOFNUZJAEJG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |