5-[(4-ethynylbenzoyl)amino]benzene-1,3-dicarboxylic acid

C17H11NO5 — CID 59499607

IUPAC5-[(4-ethynylbenzoyl)amino]benzene-1,3-dicarboxylic acid
SMILESC#Cc1ccc(C(=O)Nc2cc(C(=O)O)cc(C(=O)O)c2)cc1
InChIInChI=1S/C17H11NO5/c1-2-10-3-5-11(6-4-10)15(19)18-14-8-12(16(20)21)7-13(9-14)17(22)23/h1,3-9H,(H,18,19)(H,20,21)(H,22,23)
InChIKeyROLLFLYKGRNQNJ-UHFFFAOYSA-N
MW309.28 g/mol
LogP2.32
Rot. Bonds4

About 5-[(4-ethynylbenzoyl)amino]benzene-1,3-dicarboxylic acid

5-[(4-ethynylbenzoyl)amino]benzene-1,3-dicarboxylic acid (PubChem CID 59499607) has the molecular formula C17H11NO5 and a molecular weight of 309.28 g/mol. Its IUPAC name is 5-[(4-ethynylbenzoyl)amino]benzene-1,3-dicarboxylic acid.

Molecular Properties

Compound Name5-[(4-ethynylbenzoyl)amino]benzene-1,3-dicarboxylic acid
PubChem CID59499607
Molecular FormulaC17H11NO5
Molecular Weight309.28 g/mol
Exact Mass309.06
IUPAC Name5-[(4-ethynylbenzoyl)amino]benzene-1,3-dicarboxylic acid
SMILESC#Cc1ccc(C(=O)Nc2cc(C(=O)O)cc(C(=O)O)c2)cc1
InChIInChI=1S/C17H11NO5/c1-2-10-3-5-11(6-4-10)15(19)18-14-8-12(16(20)21)7-13(9-14)17(22)23/h1,3-9H,(H,18,19)(H,20,21)(H,22,23)
InChIKeyROLLFLYKGRNQNJ-UHFFFAOYSA-N
XLogP2.32
TPSA103.70 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500309.28
LogP ≤ 52.32
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze 5-[(4-ethynylbenzoyl)amino]benzene-1,3-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[(4-ethynylbenzoyl)amino]benzene-1,3-dicarboxylic acid?
The IUPAC name of 5-[(4-ethynylbenzoyl)amino]benzene-1,3-dicarboxylic acid (CID 59499607) is 5-[(4-ethynylbenzoyl)amino]benzene-1,3-dicarboxylic acid.
What is the SMILES notation for 5-[(4-ethynylbenzoyl)amino]benzene-1,3-dicarboxylic acid?
The canonical SMILES for 5-[(4-ethynylbenzoyl)amino]benzene-1,3-dicarboxylic acid is C#Cc1ccc(C(=O)Nc2cc(C(=O)O)cc(C(=O)O)c2)cc1.
What is the InChIKey of 5-[(4-ethynylbenzoyl)amino]benzene-1,3-dicarboxylic acid?
The InChIKey is ROLLFLYKGRNQNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11NO5/c1-2-10-3-5-11(6-4-10)15(19)18-14-8-12(16(20)21)7-13(9-14)17(22)23/h1,3-9H,(H,18,19)(H,20,21)(H,22,23).
What are the key properties of 5-[(4-ethynylbenzoyl)amino]benzene-1,3-dicarboxylic acid?
5-[(4-ethynylbenzoyl)amino]benzene-1,3-dicarboxylic acid has a molecular weight of 309.28 g/mol, XLogP of 2.32, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4-ethynylbenzoyl)amino]benzene-1,3-dicarboxylic acid is sourced from PubChem (CID 59499607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).