About 4-ethynylbenzoic acid;hydrochloride
4-ethynylbenzoic acid;hydrochloride (PubChem CID 87425407) has the molecular formula C9H7ClO2
and a molecular weight of 182.61 g/mol. Its IUPAC name is 4-ethynylbenzoic acid;hydrochloride.
Molecular Properties
| Compound Name | 4-ethynylbenzoic acid;hydrochloride |
| PubChem CID | 87425407 |
| Molecular Formula | C9H7ClO2 |
| Molecular Weight | 182.61 g/mol |
| Exact Mass | 182.01 |
| IUPAC Name | 4-ethynylbenzoic acid;hydrochloride |
| SMILES | C#Cc1ccc(C(=O)O)cc1.Cl |
| InChI | InChI=1S/C9H6O2.ClH/c1-2-7-3-5-8(6-4-7)9(10)11;/h1,3-6H,(H,10,11);1H |
| InChIKey | JBDWXIPYPWAZRV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.61 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethynylbenzoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethynylbenzoic acid;hydrochloride?
The IUPAC name of 4-ethynylbenzoic acid;hydrochloride (CID 87425407) is 4-ethynylbenzoic acid;hydrochloride.
What is the SMILES notation for 4-ethynylbenzoic acid;hydrochloride?
The canonical SMILES for 4-ethynylbenzoic acid;hydrochloride is C#Cc1ccc(C(=O)O)cc1.Cl.
What is the InChIKey of 4-ethynylbenzoic acid;hydrochloride?
The InChIKey is JBDWXIPYPWAZRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O2.ClH/c1-2-7-3-5-8(6-4-7)9(10)11;/h1,3-6H,(H,10,11);1H.
What are the key properties of 4-ethynylbenzoic acid;hydrochloride?
4-ethynylbenzoic acid;hydrochloride has a molecular weight of 182.61 g/mol, XLogP of 1.79, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethynylbenzoic acid;hydrochloride is sourced from PubChem (CID 87425407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).