C50H30N4O4 — CID 136672732
4-[10-(4-carboxyphenyl)-15,20-bis(4-ethynylphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid (PubChem CID 136672732) has the molecular formula C50H30N4O4 and a molecular weight of 750.81 g/mol. Its IUPAC name is 4-[10-(4-carboxyphenyl)-15,20-bis(4-ethynylphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid.
| Compound Name | 4-[10-(4-carboxyphenyl)-15,20-bis(4-ethynylphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid |
|---|---|
| PubChem CID | 136672732 |
| Molecular Formula | C50H30N4O4 |
| Molecular Weight | 750.81 g/mol |
| Exact Mass | 750.23 |
| IUPAC Name | 4-[10-(4-carboxyphenyl)-15,20-bis(4-ethynylphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid |
| SMILES | C#Cc1ccc(-c2c3nc(c(-c4ccc(C#C)cc4)c4ccc([nH]4)c(-c4ccc(C(=O)O)cc4)c4nc(c(-c5ccc(C(=O)O)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C50H30N4O4/c1-3-29-5-9-31(10-6-29)45-37-21-22-38(51-37)46(32-11-7-30(4-2)8-12-32)40-24-26-42(53-40)48(34-15-19-36(20-16-34)50(57)58)44-28-27-43(54-44)47(41-25-23-39(45)52-41)33-13-17-35(18-14-33)49(55)56/h1-2,5-28,52-53H,(H,55,56)(H,57,58)/b45-37-,45-39-,46-38-,46-40-,47-41-,47-43-,48-42-,48-44- |
| InChIKey | HXJCCSZGKLXXNA-DKVILZSDSA-N |
| XLogP | 10.68 |
| TPSA | 131.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.81 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|