C46H28N6 — CID 137274122
5,15-bis(4-ethynylphenyl)-10,20-dipyridin-4-yl-21,23-dihydroporphyrin (PubChem CID 137274122) has the molecular formula C46H28N6 and a molecular weight of 664.77 g/mol. Its IUPAC name is 5,15-bis(4-ethynylphenyl)-10,20-dipyridin-4-yl-21,23-dihydroporphyrin.
| Compound Name | 5,15-bis(4-ethynylphenyl)-10,20-dipyridin-4-yl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 137274122 |
| Molecular Formula | C46H28N6 |
| Molecular Weight | 664.77 g/mol |
| Exact Mass | 664.24 |
| IUPAC Name | 5,15-bis(4-ethynylphenyl)-10,20-dipyridin-4-yl-21,23-dihydroporphyrin |
| SMILES | C#Cc1ccc(-c2c3nc(c(-c4ccncc4)c4ccc([nH]4)c(-c4ccc(C#C)cc4)c4nc(c(-c5ccncc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C46H28N6/c1-3-29-5-9-31(10-6-29)43-35-13-17-39(49-35)45(33-21-25-47-26-22-33)41-19-15-37(51-41)44(32-11-7-30(4-2)8-12-32)38-16-20-42(52-38)46(34-23-27-48-28-24-34)40-18-14-36(43)50-40/h1-2,5-28,49,52H/b43-35-,43-36-,44-37-,44-38-,45-39-,45-41-,46-40-,46-42- |
| InChIKey | LWAQPCBEUZCRLO-ZTRVSJDYSA-N |
| XLogP | 10.08 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.77 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|