C48H26N8Zn — CID 175086451
4-[10,15,20-tris(4-cyanophenyl)-21,23-dihydroporphyrin-5-yl]benzonitrile;zinc (PubChem CID 175086451) has the molecular formula C48H26N8Zn and a molecular weight of 780.18 g/mol. Its IUPAC name is 4-[10,15,20-tris(4-cyanophenyl)-21,23-dihydroporphyrin-5-yl]benzonitrile;zinc.
| Compound Name | 4-[10,15,20-tris(4-cyanophenyl)-21,23-dihydroporphyrin-5-yl]benzonitrile;zinc |
|---|---|
| PubChem CID | 175086451 |
| Molecular Formula | C48H26N8Zn |
| Molecular Weight | 780.18 g/mol |
| Exact Mass | 778.16 |
| IUPAC Name | 4-[10,15,20-tris(4-cyanophenyl)-21,23-dihydroporphyrin-5-yl]benzonitrile;zinc |
| SMILES | N#Cc1ccc(-c2c3nc(c(-c4ccc(C#N)cc4)c4ccc([nH]4)c(-c4ccc(C#N)cc4)c4nc(c(-c5ccc(C#N)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1.[Zn] |
| InChI | InChI=1S/C48H26N8.Zn/c49-25-29-1-9-33(10-2-29)45-37-17-19-39(53-37)46(34-11-3-30(26-50)4-12-34)41-21-23-43(55-41)48(36-15-7-32(28-52)8-16-36)44-24-22-42(56-44)47(40-20-18-38(45)54-40)35-13-5-31(27-51)6-14-35;/h1-24,53,56H;/b45-37-,45-38-,46-39-,46-41-,47-40-,47-42-,48-43-,48-44-; |
| InChIKey | LMJOUJXJGWZRNZ-NHZJRHMYSA-N |
| XLogP | 10.81 |
| TPSA | 152.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.18 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|