C45H29N5 — CID 136695460
3-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)benzonitrile (PubChem CID 136695460) has the molecular formula C45H29N5 and a molecular weight of 639.76 g/mol. Its IUPAC name is 3-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)benzonitrile.
| Compound Name | 3-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)benzonitrile |
|---|---|
| PubChem CID | 136695460 |
| Molecular Formula | C45H29N5 |
| Molecular Weight | 639.76 g/mol |
| Exact Mass | 639.24 |
| IUPAC Name | 3-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)benzonitrile |
| SMILES | N#Cc1cccc(-c2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)c1 |
| InChI | InChI=1S/C45H29N5/c46-28-29-11-10-18-33(27-29)45-40-25-23-38(49-40)43(31-14-6-2-7-15-31)36-21-19-34(47-36)42(30-12-4-1-5-13-30)35-20-22-37(48-35)44(32-16-8-3-9-17-32)39-24-26-41(45)50-39/h1-27,47,50H/b42-34-,42-35-,43-36-,43-38-,44-37-,44-39-,45-40-,45-41- |
| InChIKey | YGMXAXXLSOFOKD-HIXPDHBDSA-N |
| XLogP | 11.20 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.76 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |