C80H42N8 — CID 16733126
4-[2-[4-[10,15,20-tris[4-[2-(4-cyanophenyl)ethynyl]phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]ethynyl]benzonitrile (PubChem CID 16733126) has the molecular formula C80H42N8 and a molecular weight of 1115.27 g/mol. Its IUPAC name is 4-[2-[4-[10,15,20-tris[4-[2-(4-cyanophenyl)ethynyl]phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]ethynyl]benzonitrile.
| Compound Name | 4-[2-[4-[10,15,20-tris[4-[2-(4-cyanophenyl)ethynyl]phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]ethynyl]benzonitrile |
|---|---|
| PubChem CID | 16733126 |
| Molecular Formula | C80H42N8 |
| Molecular Weight | 1115.27 g/mol |
| Exact Mass | 1114.35 |
| IUPAC Name | 4-[2-[4-[10,15,20-tris[4-[2-(4-cyanophenyl)ethynyl]phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]ethynyl]benzonitrile |
| SMILES | N#Cc1ccc(C#Cc2ccc(-c3c4nc(c(-c5ccc(C#Cc6ccc(C#N)cc6)cc5)c5ccc([nH]5)c(-c5ccc(C#Cc6ccc(C#N)cc6)cc5)c5nc(c(-c6ccc(C#Cc7ccc(C#N)cc7)cc6)c6ccc3[nH]6)C=C5)C=C4)cc2)cc1 |
| InChI | InChI=1S/C80H42N8/c81-49-61-17-9-53(10-18-61)1-5-57-25-33-65(34-26-57)77-69-41-43-71(85-69)78(66-35-27-58(28-36-66)6-2-54-11-19-62(50-82)20-12-54)73-45-47-75(87-73)80(68-39-31-60(32-40-68)8-4-56-15-23-64(52-84)24-16-56)76-48-46-74(88-76)79(72-44-42-70(77)86-72)67-37-29-59(30-38-67)7-3-55-13-21-63(51-83)22-14-55/h9-48,85,88H/b77-69-,77-70-,78-71-,78-73-,79-72-,79-74-,80-75-,80-76- |
| InChIKey | FJYBHDQDXZWQCL-YYORVEAWSA-N |
| XLogP | 16.41 |
| TPSA | 152.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 88 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1115.27 |
| LogP ≤ 5 | 16.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|