C48H26N8 — CID 135476636
4-[2,7,17-tris(4-cyanophenyl)-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,4,6(24),7,9,11,13(22),14,16,18-undecaen-12-yl]benzonitrile (PubChem CID 135476636) has the molecular formula C48H26N8 and a molecular weight of 714.79 g/mol. Its IUPAC name is 4-[2,7,17-tris(4-cyanophenyl)-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,4,6(24),7,9,11,13(22),14,16,18-undecaen-12-yl]benzonitrile.
| Compound Name | 4-[2,7,17-tris(4-cyanophenyl)-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,4,6(24),7,9,11,13(22),14,16,18-undecaen-12-yl]benzonitrile |
|---|---|
| PubChem CID | 135476636 |
| Molecular Formula | C48H26N8 |
| Molecular Weight | 714.79 g/mol |
| Exact Mass | 714.23 |
| IUPAC Name | 4-[2,7,17-tris(4-cyanophenyl)-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,4,6(24),7,9,11,13(22),14,16,18-undecaen-12-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2c3cc(c(-c4ccc(C#N)cc4)c4ccc([nH]4)c(-c4ccc(C#N)cc4)c4nc(c(-c5ccc(C#N)cc5)c5ccc2[nH]5)C=C4)N=C3)cc1 |
| InChI | InChI=1S/C48H26N8/c49-24-29-1-9-33(10-2-29)45-37-23-44(53-28-37)48(36-15-7-32(27-52)8-16-36)43-22-21-42(56-43)47(35-13-5-31(26-51)6-14-35)41-20-19-40(55-41)46(39-18-17-38(45)54-39)34-11-3-30(25-50)4-12-34/h1-23,28,54,56H/b45-37+,45-38-,46-39-,46-40-,47-41-,47-42-,48-43-,48-44+ |
| InChIKey | WHJWWAAOCJAXBV-BTANPNPPSA-N |
| XLogP | 11.00 |
| TPSA | 151.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.79 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |