C47H22F5N7 — CID 136814732
4-[10,20-bis(4-cyanophenyl)-15-(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin-5-yl]benzonitrile (PubChem CID 136814732) has the molecular formula C47H22F5N7 and a molecular weight of 779.73 g/mol. Its IUPAC name is 4-[10,20-bis(4-cyanophenyl)-15-(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin-5-yl]benzonitrile.
| Compound Name | 4-[10,20-bis(4-cyanophenyl)-15-(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin-5-yl]benzonitrile |
|---|---|
| PubChem CID | 136814732 |
| Molecular Formula | C47H22F5N7 |
| Molecular Weight | 779.73 g/mol |
| Exact Mass | 779.19 |
| IUPAC Name | 4-[10,20-bis(4-cyanophenyl)-15-(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin-5-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2c3nc(c(-c4ccc(C#N)cc4)c4ccc([nH]4)c(-c4c(F)c(F)c(F)c(F)c4F)c4nc(c(-c5ccc(C#N)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C47H22F5N7/c48-43-42(44(49)46(51)47(52)45(43)50)41-36-19-17-34(58-36)39(28-9-3-25(22-54)4-10-28)32-15-13-30(56-32)38(27-7-1-24(21-53)2-8-27)31-14-16-33(57-31)40(35-18-20-37(41)59-35)29-11-5-26(23-55)6-12-29/h1-20,56,59H/b38-30-,38-31-,39-32-,39-34-,40-33-,40-35-,41-36+,41-37+ |
| InChIKey | OLDNHTJSODGEMO-GZYNPNTOSA-N |
| XLogP | 11.63 |
| TPSA | 128.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.73 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|