C33H8F15N3 — CID 102382676
2,7,12-tris(2,3,4,5,6-pentafluorophenyl)-16,17,18-triazatetracyclo[11.2.1.13,6.18,11]octadeca-1(16),2,4,6,8,10,12,14-octaene (PubChem CID 102382676) has the molecular formula C33H8F15N3 and a molecular weight of 731.42 g/mol. Its IUPAC name is 2,7,12-tris(2,3,4,5,6-pentafluorophenyl)-16,17,18-triazatetracyclo[11.2.1.13,6.18,11]octadeca-1(16),2,4,6,8,10,12,14-octaene.
| Compound Name | 2,7,12-tris(2,3,4,5,6-pentafluorophenyl)-16,17,18-triazatetracyclo[11.2.1.13,6.18,11]octadeca-1(16),2,4,6,8,10,12,14-octaene |
|---|---|
| PubChem CID | 102382676 |
| Molecular Formula | C33H8F15N3 |
| Molecular Weight | 731.42 g/mol |
| Exact Mass | 731.05 |
| IUPAC Name | 2,7,12-tris(2,3,4,5,6-pentafluorophenyl)-16,17,18-triazatetracyclo[11.2.1.13,6.18,11]octadeca-1(16),2,4,6,8,10,12,14-octaene |
| SMILES | Fc1c(F)c(F)c(-c2c3nc(c(-c4c(F)c(F)c(F)c(F)c4F)c4ccc([nH]4)c(-c4c(F)c(F)c(F)c(F)c4F)c4ccc2[nH]4)C=C3)c(F)c1F |
| InChI | InChI=1S/C33H8F15N3/c34-19-16(20(35)26(41)31(46)25(19)40)13-7-1-2-8(49-7)14(17-21(36)27(42)32(47)28(43)22(17)37)10-5-6-12(51-10)15(11-4-3-9(13)50-11)18-23(38)29(44)33(48)30(45)24(18)39/h1-6,49-50H/b13-7-,13-9+,14-8-,14-10+,15-11+,15-12+ |
| InChIKey | WRZXPUZGEFKNEE-FZXNMELISA-N |
| XLogP | 10.74 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.42 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|