C38H15F10N5 — CID 136859879
4-[5,15-bis(2,3,4,5,6-pentafluorophenyl)-22,23-dihydro-21H-corrin-10-yl]benzonitrile (PubChem CID 136859879) has the molecular formula C38H15F10N5 and a molecular weight of 731.55 g/mol. Its IUPAC name is 4-[5,15-bis(2,3,4,5,6-pentafluorophenyl)-22,23-dihydro-21H-corrin-10-yl]benzonitrile.
| Compound Name | 4-[5,15-bis(2,3,4,5,6-pentafluorophenyl)-22,23-dihydro-21H-corrin-10-yl]benzonitrile |
|---|---|
| PubChem CID | 136859879 |
| Molecular Formula | C38H15F10N5 |
| Molecular Weight | 731.55 g/mol |
| Exact Mass | 731.12 |
| IUPAC Name | 4-[5,15-bis(2,3,4,5,6-pentafluorophenyl)-22,23-dihydro-21H-corrin-10-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2c3ccc([nH]3)c(-c3c(F)c(F)c(F)c(F)c3F)c3nc(c4ccc([nH]4)c(-c4c(F)c(F)c(F)c(F)c4F)c4ccc2[nH]4)C=C3)cc1 |
| InChI | InChI=1S/C38H15F10N5/c39-29-27(30(40)34(44)37(47)33(29)43)25-20-7-5-16(50-20)17-6-8-21(51-17)26(28-31(41)35(45)38(48)36(46)32(28)42)23-12-10-19(53-23)24(18-9-11-22(25)52-18)15-3-1-14(13-49)2-4-15/h1-12,50,52-53H/b17-16-,24-18-,24-19-,25-20+,25-22+,26-21+,26-23+ |
| InChIKey | MNIKEWNVEKPIBG-WEDLHJAXSA-N |
| XLogP | 10.96 |
| TPSA | 84.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.55 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|